C23H36O5S — CID 3287256
[10,13-dimethyl-17-(methylsulfonyloxymethyl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 3287256) has the molecular formula C23H36O5S and a molecular weight of 424.60 g/mol. Its IUPAC name is [10,13-dimethyl-17-(methylsulfonyloxymethyl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [10,13-dimethyl-17-(methylsulfonyloxymethyl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 3287256 |
| Molecular Formula | C23H36O5S |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | [10,13-dimethyl-17-(methylsulfonyloxymethyl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3C4=CCC(COS(C)(=O)=O)C4(C)CCC32)C1 |
| InChI | InChI=1S/C23H36O5S/c1-15(24)28-18-9-11-22(2)16(13-18)5-7-19-20-8-6-17(14-27-29(4,25)26)23(20,3)12-10-21(19)22/h8,16-19,21H,5-7,9-14H2,1-4H3 |
| InChIKey | SBINUGUVXWZQRO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|