C19H17N3O2S — CID 3288975
6-[2-(1-phenylethylamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 3288975) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 6-[2-(1-phenylethylamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(1-phenylethylamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 3288975 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 6-[2-(1-phenylethylamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(Nc1nc(-c2ccc3c(c2)NC(=O)CO3)cs1)c1ccccc1 |
| InChI | InChI=1S/C19H17N3O2S/c1-12(13-5-3-2-4-6-13)20-19-22-16(11-25-19)14-7-8-17-15(9-14)21-18(23)10-24-17/h2-9,11-12H,10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | BLOSZOWUKOEJEQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |