About (-)-Amphetamine
(-)-Amphetamine (PubChem CID 32893) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is (2R)-1-phenylpropan-2-amine.
Molecular Properties
| Compound Name | (-)-Amphetamine |
| PubChem CID | 32893 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (2R)-1-phenylpropan-2-amine |
| SMILES | C[C@H](CC1=CC=CC=C1)N |
| InChI | InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/t8-/m1/s1 |
| InChIKey | KWTSXDURSIMDCE-MRVPVSSYSA-N |
| XLogP | 1.80 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | 84 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (-)-Amphetamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (-)-Amphetamine?
The IUPAC name of (-)-Amphetamine (CID 32893) is (2R)-1-phenylpropan-2-amine.
What is the SMILES notation for (-)-Amphetamine?
The canonical SMILES for (-)-Amphetamine is C[C@H](CC1=CC=CC=C1)N.
What is the InChIKey of (-)-Amphetamine?
The InChIKey is KWTSXDURSIMDCE-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/t8-/m1/s1.
What are the key properties of (-)-Amphetamine?
(-)-Amphetamine has a molecular weight of 135.21 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (-)-Amphetamine is sourced from PubChem (CID 32893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).