C13H20N2O4 — CID 3289696
2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetic acid (PubChem CID 3289696) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetic acid.
| Compound Name | 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetic acid |
|---|---|
| PubChem CID | 3289696 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetic acid |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)O)C2=O |
| InChI | InChI=1S/C13H20N2O4/c1-8-4-12(2,3)7-13(5-8)10(18)15(6-9(16)17)11(19)14-13/h8H,4-7H2,1-3H3,(H,14,19)(H,16,17) |
| InChIKey | MWVCTRQTVQEROJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|