C22H20N6O3S2 — CID 32898959
N'-[2-[[4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 32898959) has the molecular formula C22H20N6O3S2 and a molecular weight of 480.58 g/mol. Its IUPAC name is N'-[2-[[4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[2-[[4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 32898959 |
| Molecular Formula | C22H20N6O3S2 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N'-[2-[[4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | COc1ccc(-n2cnnc2SCC(=O)NNC(=O)c2sc(-c3ccccc3)nc2C)cc1 |
| InChI | InChI=1S/C22H20N6O3S2/c1-14-19(33-21(24-14)15-6-4-3-5-7-15)20(30)26-25-18(29)12-32-22-27-23-13-28(22)16-8-10-17(31-2)11-9-16/h3-11,13H,12H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | NBIDOZUAKUIFNY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|