About 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole
2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole (PubChem CID 3289934) has the molecular formula C20H15N5S
and a molecular weight of 357.44 g/mol. Its IUPAC name is 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole |
| PubChem CID | 3289934 |
| Molecular Formula | C20H15N5S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole |
| SMILES | Cc1ccc(-n2cc3c(-c4nc5ccccc5s4)nnc(C)c3n2)cc1 |
| InChI | InChI=1S/C20H15N5S/c1-12-7-9-14(10-8-12)25-11-15-18(24-25)13(2)22-23-19(15)20-21-16-5-3-4-6-17(16)26-20/h3-11H,1-2H3 |
| InChIKey | CXKHWDCDZUDAAL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole?
The IUPAC name of 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole (CID 3289934) is 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole.
What is the SMILES notation for 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole?
The canonical SMILES for 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole is Cc1ccc(-n2cc3c(-c4nc5ccccc5s4)nnc(C)c3n2)cc1.
What is the InChIKey of 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole?
The InChIKey is CXKHWDCDZUDAAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N5S/c1-12-7-9-14(10-8-12)25-11-15-18(24-25)13(2)22-23-19(15)20-21-16-5-3-4-6-17(16)26-20/h3-11H,1-2H3.
What are the key properties of 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole?
2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole has a molecular weight of 357.44 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-methyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-4-yl]-1,3-benzothiazole is sourced from PubChem (CID 3289934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).