C17H16FNO2S — CID 3290034
1-[2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]-2-phenoxyethanone (PubChem CID 3290034) has the molecular formula C17H16FNO2S and a molecular weight of 317.38 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]-2-phenoxyethanone.
| Compound Name | 1-[2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 3290034 |
| Molecular Formula | C17H16FNO2S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCSC1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FNO2S/c18-14-8-6-13(7-9-14)17-19(10-11-22-17)16(20)12-21-15-4-2-1-3-5-15/h1-9,17H,10-12H2 |
| InChIKey | ZRCUCWZNWFWNSC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |