C16H46O8Si8 — CID 3290111
2-[2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 3290111) has the molecular formula C16H46O8Si8 and a molecular weight of 591.22 g/mol. Its IUPAC name is 2-[2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-[2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 3290111 |
| Molecular Formula | C16H46O8Si8 |
| Molecular Weight | 591.22 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | 2-[2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(CC[Si]2(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O2)O[Si](C)(C)O1 |
| InChI | InChI=1S/C16H46O8Si8/c1-25(2)17-27(5,6)21-31(13,22-28(7,8)18-25)15-16-32(14)23-29(9,10)19-26(3,4)20-30(11,12)24-32/h15-16H2,1-14H3 |
| InChIKey | GNRXEMRWWYVGCK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.22 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|