About 2-(2-fluorophenyl)-1,8-naphthyridine
2-(2-fluorophenyl)-1,8-naphthyridine (PubChem CID 3290795) has the molecular formula C14H9FN2
and a molecular weight of 224.24 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-(2-fluorophenyl)-1,8-naphthyridine |
| PubChem CID | 3290795 |
| Molecular Formula | C14H9FN2 |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-(2-fluorophenyl)-1,8-naphthyridine |
| SMILES | Fc1ccccc1-c1ccc2cccnc2n1 |
| InChI | InChI=1S/C14H9FN2/c15-12-6-2-1-5-11(12)13-8-7-10-4-3-9-16-14(10)17-13/h1-9H |
| InChIKey | MILFHVJJOVHZIF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-fluorophenyl)-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenyl)-1,8-naphthyridine?
The IUPAC name of 2-(2-fluorophenyl)-1,8-naphthyridine (CID 3290795) is 2-(2-fluorophenyl)-1,8-naphthyridine.
What is the SMILES notation for 2-(2-fluorophenyl)-1,8-naphthyridine?
The canonical SMILES for 2-(2-fluorophenyl)-1,8-naphthyridine is Fc1ccccc1-c1ccc2cccnc2n1.
What is the InChIKey of 2-(2-fluorophenyl)-1,8-naphthyridine?
The InChIKey is MILFHVJJOVHZIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9FN2/c15-12-6-2-1-5-11(12)13-8-7-10-4-3-9-16-14(10)17-13/h1-9H.
What are the key properties of 2-(2-fluorophenyl)-1,8-naphthyridine?
2-(2-fluorophenyl)-1,8-naphthyridine has a molecular weight of 224.24 g/mol, XLogP of 3.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenyl)-1,8-naphthyridine is sourced from PubChem (CID 3290795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).