About 1,3-bis(1-phenylethyl)urea
1,3-bis(1-phenylethyl)urea (PubChem CID 3291438) has the molecular formula C17H20N2O
and a molecular weight of 268.36 g/mol. Its IUPAC name is 1,3-bis(1-phenylethyl)urea.
Molecular Properties
| Compound Name | 1,3-bis(1-phenylethyl)urea |
| PubChem CID | 3291438 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1,3-bis(1-phenylethyl)urea |
| SMILES | CC(NC(=O)NC(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O/c1-13(15-9-5-3-6-10-15)18-17(20)19-14(2)16-11-7-4-8-12-16/h3-14H,1-2H3,(H2,18,19,20) |
| InChIKey | DECSQLJEZMEBEG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-bis(1-phenylethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(1-phenylethyl)urea?
The IUPAC name of 1,3-bis(1-phenylethyl)urea (CID 3291438) is 1,3-bis(1-phenylethyl)urea.
What is the SMILES notation for 1,3-bis(1-phenylethyl)urea?
The canonical SMILES for 1,3-bis(1-phenylethyl)urea is CC(NC(=O)NC(C)c1ccccc1)c1ccccc1.
What is the InChIKey of 1,3-bis(1-phenylethyl)urea?
The InChIKey is DECSQLJEZMEBEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O/c1-13(15-9-5-3-6-10-15)18-17(20)19-14(2)16-11-7-4-8-12-16/h3-14H,1-2H3,(H2,18,19,20).
What are the key properties of 1,3-bis(1-phenylethyl)urea?
1,3-bis(1-phenylethyl)urea has a molecular weight of 268.36 g/mol, XLogP of 3.81, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(1-phenylethyl)urea is sourced from PubChem (CID 3291438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).