About 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione
3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione (PubChem CID 3291517) has the molecular formula C23H32N4O5
and a molecular weight of 444.53 g/mol. Its IUPAC name is 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione.
Molecular Properties
| Compound Name | 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione |
| PubChem CID | 3291517 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(-c1ccc(OCCC)c(OCC)c1)n2CCOC |
| InChI | InChI=1S/C23H32N4O5/c1-5-8-11-27-21-19(22(28)25-23(27)29)26(12-14-30-4)20(24-21)16-9-10-17(32-13-6-2)18(15-16)31-7-3/h9-10,15H,5-8,11-14H2,1-4H3,(H,25,28,29) |
| InChIKey | LLXMPJBHBTWIIU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione?
The IUPAC name of 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione (CID 3291517) is 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione.
What is the SMILES notation for 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione?
The canonical SMILES for 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione is CCCCn1c(=O)[nH]c(=O)c2c1nc(-c1ccc(OCCC)c(OCC)c1)n2CCOC.
What is the InChIKey of 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione?
The InChIKey is LLXMPJBHBTWIIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N4O5/c1-5-8-11-27-21-19(22(28)25-23(27)29)26(12-14-30-4)20(24-21)16-9-10-17(32-13-6-2)18(15-16)31-7-3/h9-10,15H,5-8,11-14H2,1-4H3,(H,25,28,29).
What are the key properties of 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione?
3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione has a molecular weight of 444.53 g/mol, XLogP of 3.19, 12 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-8-(3-ethoxy-4-propoxyphenyl)-7-(2-methoxyethyl)purine-2,6-dione is sourced from PubChem (CID 3291517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).