C10H11NO3 — CID 32916
N-hydroxy-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 32916) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is N-hydroxy-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | N-hydroxy-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 32916 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | N-hydroxy-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COC1=CC=C(C=C1)C=CC(=O)NO |
| InChIKey | BQDLTSGIXOYYHY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | 207 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|