About [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate
[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate (PubChem CID 3291643) has the molecular formula C18H22N2O5S
and a molecular weight of 378.45 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate |
| PubChem CID | 3291643 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate |
| SMILES | CC(C)CN(C(=O)COC(=O)c1ccc(C#N)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H22N2O5S/c1-13(2)10-20(16-7-8-26(23,24)12-16)17(21)11-25-18(22)15-5-3-14(9-19)4-6-15/h3-6,13,16H,7-8,10-12H2,1-2H3 |
| InChIKey | DUCWSRYXAFFRRZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate (CID 3291643) is [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate is CC(C)CN(C(=O)COC(=O)c1ccc(C#N)cc1)C1CCS(=O)(=O)C1.
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate?
The InChIKey is DUCWSRYXAFFRRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O5S/c1-13(2)10-20(16-7-8-26(23,24)12-16)17(21)11-25-18(22)15-5-3-14(9-19)4-6-15/h3-6,13,16H,7-8,10-12H2,1-2H3.
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate?
[2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate has a molecular weight of 378.45 g/mol, XLogP of 1.39, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)-(2-methylpropyl)amino]-2-oxoethyl] 4-cyanobenzoate is sourced from PubChem (CID 3291643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).