C21H13ClN2O5S — CID 3291661
4-(3-chloro-2-cyanophenoxy)-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide (PubChem CID 3291661) has the molecular formula C21H13ClN2O5S and a molecular weight of 440.86 g/mol. Its IUPAC name is 4-(3-chloro-2-cyanophenoxy)-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide.
| Compound Name | 4-(3-chloro-2-cyanophenoxy)-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3291661 |
| Molecular Formula | C21H13ClN2O5S |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 4-(3-chloro-2-cyanophenoxy)-N-(3-oxo-1H-2-benzofuran-5-yl)benzenesulfonamide |
| SMILES | N#Cc1c(Cl)cccc1Oc1ccc(S(=O)(=O)Nc2ccc3c(c2)C(=O)OC3)cc1 |
| InChI | InChI=1S/C21H13ClN2O5S/c22-19-2-1-3-20(18(19)11-23)29-15-6-8-16(9-7-15)30(26,27)24-14-5-4-13-12-28-21(25)17(13)10-14/h1-10,24H,12H2 |
| InChIKey | YMYZHPKAZNRIMJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |