C18H14FNO3S — CID 3291774
methyl 2-[3-[(4-fluorophenyl)methoxy]-1,4-benzothiazin-2-ylidene]acetate (PubChem CID 3291774) has the molecular formula C18H14FNO3S and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl 2-[3-[(4-fluorophenyl)methoxy]-1,4-benzothiazin-2-ylidene]acetate.
| Compound Name | methyl 2-[3-[(4-fluorophenyl)methoxy]-1,4-benzothiazin-2-ylidene]acetate |
|---|---|
| PubChem CID | 3291774 |
| Molecular Formula | C18H14FNO3S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | methyl 2-[3-[(4-fluorophenyl)methoxy]-1,4-benzothiazin-2-ylidene]acetate |
| SMILES | COC(=O)C=C1Sc2ccccc2N=C1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FNO3S/c1-22-17(21)10-16-18(20-14-4-2-3-5-15(14)24-16)23-11-12-6-8-13(19)9-7-12/h2-10H,11H2,1H3 |
| InChIKey | IOONWBXKHDIMFJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|