C15H19N3O5 — CID 32919661
N-methyl-N-(4-methylcyclohexyl)-3,5-dinitrobenzamide (PubChem CID 32919661) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is N-methyl-N-(4-methylcyclohexyl)-3,5-dinitrobenzamide.
| Compound Name | N-methyl-N-(4-methylcyclohexyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 32919661 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-methyl-N-(4-methylcyclohexyl)-3,5-dinitrobenzamide |
| SMILES | CC1CCC(N(C)C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C15H19N3O5/c1-10-3-5-12(6-4-10)16(2)15(19)11-7-13(17(20)21)9-14(8-11)18(22)23/h7-10,12H,3-6H2,1-2H3 |
| InChIKey | ZUHGEYYPXNZYGU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|