C25H29FN2O2 — CID 3292138
1-cycloheptyl-3-(4-fluorophenyl)-4-(2-phenylethyl)piperazine-2,5-dione (PubChem CID 3292138) has the molecular formula C25H29FN2O2 and a molecular weight of 408.52 g/mol. Its IUPAC name is 1-cycloheptyl-3-(4-fluorophenyl)-4-(2-phenylethyl)piperazine-2,5-dione.
| Compound Name | 1-cycloheptyl-3-(4-fluorophenyl)-4-(2-phenylethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 3292138 |
| Molecular Formula | C25H29FN2O2 |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-cycloheptyl-3-(4-fluorophenyl)-4-(2-phenylethyl)piperazine-2,5-dione |
| SMILES | O=C1C(c2ccc(F)cc2)N(CCc2ccccc2)C(=O)CN1C1CCCCCC1 |
| InChI | InChI=1S/C25H29FN2O2/c26-21-14-12-20(13-15-21)24-25(30)28(22-10-6-1-2-7-11-22)18-23(29)27(24)17-16-19-8-4-3-5-9-19/h3-5,8-9,12-15,22,24H,1-2,6-7,10-11,16-18H2 |
| InChIKey | ZYZSQQLXKCUBEG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |