C17H21N3O4S — CID 3292313
3-amino-N-(4-methoxyphenyl)-4-morpholin-4-ylbenzenesulfonamide (PubChem CID 3292313) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-amino-N-(4-methoxyphenyl)-4-morpholin-4-ylbenzenesulfonamide.
| Compound Name | 3-amino-N-(4-methoxyphenyl)-4-morpholin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 3292313 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-amino-N-(4-methoxyphenyl)-4-morpholin-4-ylbenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(N3CCOCC3)c(N)c2)cc1 |
| InChI | InChI=1S/C17H21N3O4S/c1-23-14-4-2-13(3-5-14)19-25(21,22)15-6-7-17(16(18)12-15)20-8-10-24-11-9-20/h2-7,12,19H,8-11,18H2,1H3 |
| InChIKey | CJCRCJOYANWZJE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|