C13H15N — CID 3292772
4a-methyl-1,2,3,4-tetrahydrocarbazole (PubChem CID 3292772) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 4a-methyl-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 4a-methyl-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 3292772 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4a-methyl-1,2,3,4-tetrahydrocarbazole |
| SMILES | CC12CCCCC1=Nc1ccccc12 |
| InChI | InChI=1S/C13H15N/c1-13-9-5-4-8-12(13)14-11-7-3-2-6-10(11)13/h2-3,6-7H,4-5,8-9H2,1H3 |
| InChIKey | QUAWBDFZLBLKCC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |