C7H8N2O4S — CID 3292774
6-acetamidopyridine-3-sulfonic acid (PubChem CID 3292774) has the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. Its IUPAC name is 6-acetamidopyridine-3-sulfonic acid.
| Compound Name | 6-acetamidopyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 3292774 |
| Molecular Formula | C7H8N2O4S |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 6-acetamidopyridine-3-sulfonic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)O)cn1 |
| InChI | InChI=1S/C7H8N2O4S/c1-5(10)9-7-3-2-6(4-8-7)14(11,12)13/h2-4H,1H3,(H,8,9,10)(H,11,12,13) |
| InChIKey | MLPFKRKLOJUNSH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|