About [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate
[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 32928952) has the molecular formula C20H15FN2O4S
and a molecular weight of 398.42 g/mol. Its IUPAC name is [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate.
Molecular Properties
| Compound Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate |
| PubChem CID | 32928952 |
| Molecular Formula | C20H15FN2O4S |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | O=C(CCc1ncc(-c2ccc(F)cc2)o1)OCc1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C20H15FN2O4S/c21-14-5-3-13(4-6-14)17-10-22-18(27-17)7-8-19(24)26-11-15-12-28-20(23-15)16-2-1-9-25-16/h1-6,9-10,12H,7-8,11H2 |
| InChIKey | CJRRXCXFCGZKFT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate?
The IUPAC name of [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate (CID 32928952) is [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate.
What is the SMILES notation for [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate?
The canonical SMILES for [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate is O=C(CCc1ncc(-c2ccc(F)cc2)o1)OCc1csc(-c2ccco2)n1.
What is the InChIKey of [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate?
The InChIKey is CJRRXCXFCGZKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15FN2O4S/c21-14-5-3-13(4-6-14)17-10-22-18(27-17)7-8-19(24)26-11-15-12-28-20(23-15)16-2-1-9-25-16/h1-6,9-10,12H,7-8,11H2.
What are the key properties of [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate?
[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate has a molecular weight of 398.42 g/mol, XLogP of 4.87, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate is sourced from PubChem (CID 32928952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).