About 6-ethoxy-2,2,4-trimethyl-1H-quinoline
6-ethoxy-2,2,4-trimethyl-1H-quinoline (PubChem CID 3293) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 6-ethoxy-2,2,4-trimethyl-1H-quinoline.
Molecular Properties
| Compound Name | 6-ethoxy-2,2,4-trimethyl-1H-quinoline |
| PubChem CID | 3293 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 6-ethoxy-2,2,4-trimethyl-1H-quinoline |
| SMILES | CCOc1ccc2c(c1)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C14H19NO/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-9,15H,5H2,1-4H3 |
| InChIKey | DECIPOUIJURFOJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxy-2,2,4-trimethyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-2,2,4-trimethyl-1H-quinoline?
The IUPAC name of 6-ethoxy-2,2,4-trimethyl-1H-quinoline (CID 3293) is 6-ethoxy-2,2,4-trimethyl-1H-quinoline.
What is the SMILES notation for 6-ethoxy-2,2,4-trimethyl-1H-quinoline?
The canonical SMILES for 6-ethoxy-2,2,4-trimethyl-1H-quinoline is CCOc1ccc2c(c1)C(C)=CC(C)(C)N2.
What is the InChIKey of 6-ethoxy-2,2,4-trimethyl-1H-quinoline?
The InChIKey is DECIPOUIJURFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-9,15H,5H2,1-4H3.
What are the key properties of 6-ethoxy-2,2,4-trimethyl-1H-quinoline?
6-ethoxy-2,2,4-trimethyl-1H-quinoline has a molecular weight of 217.31 g/mol, XLogP of 3.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-2,2,4-trimethyl-1H-quinoline is sourced from PubChem (CID 3293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).