C16H19N3O4 — CID 32934057
1-(2-methoxyethyl)-6-oxo-N-(2-phenoxyethyl)pyridazine-3-carboxamide (PubChem CID 32934057) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-6-oxo-N-(2-phenoxyethyl)pyridazine-3-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-6-oxo-N-(2-phenoxyethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 32934057 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-(2-methoxyethyl)-6-oxo-N-(2-phenoxyethyl)pyridazine-3-carboxamide |
| SMILES | COCCn1nc(C(=O)NCCOc2ccccc2)ccc1=O |
| InChI | InChI=1S/C16H19N3O4/c1-22-12-10-19-15(20)8-7-14(18-19)16(21)17-9-11-23-13-5-3-2-4-6-13/h2-8H,9-12H2,1H3,(H,17,21) |
| InChIKey | IRKIZQVGNBTMGN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|