C22H21N3O4 — CID 32934602
6-(2,5-dimethylfuran-3-yl)-3-methyl-N-(2-phenoxyethyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 32934602) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 6-(2,5-dimethylfuran-3-yl)-3-methyl-N-(2-phenoxyethyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-(2,5-dimethylfuran-3-yl)-3-methyl-N-(2-phenoxyethyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 32934602 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 6-(2,5-dimethylfuran-3-yl)-3-methyl-N-(2-phenoxyethyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(-c2cc(C(=O)NCCOc3ccccc3)c3c(C)noc3n2)c(C)o1 |
| InChI | InChI=1S/C22H21N3O4/c1-13-11-17(15(3)28-13)19-12-18(20-14(2)25-29-22(20)24-19)21(26)23-9-10-27-16-7-5-4-6-8-16/h4-8,11-12H,9-10H2,1-3H3,(H,23,26) |
| InChIKey | NHGLQBZVFRMOJQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|