C21H17N3O6 — CID 3293700
4-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 3293700) has the molecular formula C21H17N3O6 and a molecular weight of 407.38 g/mol. Its IUPAC name is 4-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 3293700 |
| Molecular Formula | C21H17N3O6 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(C=NN2C(=O)C3C4C=CC(C4)C3C2=O)o1 |
| InChI | InChI=1S/C21H17N3O6/c1-29-17-9-13(24(27)28)4-6-15(17)16-7-5-14(30-16)10-22-23-20(25)18-11-2-3-12(8-11)19(18)21(23)26/h2-7,9-12,18-19H,8H2,1H3 |
| InChIKey | LQABIGUYVQVORN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 115.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|