C20H23N3O5 — CID 32940179
N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-2-[(2-phenoxyacetyl)amino]acetamide (PubChem CID 32940179) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-2-[(2-phenoxyacetyl)amino]acetamide.
| Compound Name | N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-2-[(2-phenoxyacetyl)amino]acetamide |
|---|---|
| PubChem CID | 32940179 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-2-[(2-phenoxyacetyl)amino]acetamide |
| SMILES | CCNC(=O)COc1ccc(NC(=O)CNC(=O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23N3O5/c1-2-21-19(25)13-28-17-10-8-15(9-11-17)23-18(24)12-22-20(26)14-27-16-6-4-3-5-7-16/h3-11H,2,12-14H2,1H3,(H,21,25)(H,22,26)(H,23,24) |
| InChIKey | MEJIRDRTZADGEE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |