About 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide
2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide (PubChem CID 3294423) has the molecular formula C7H6N2O2S
and a molecular weight of 182.20 g/mol. Its IUPAC name is 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide.
Molecular Properties
| Compound Name | 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide |
| PubChem CID | 3294423 |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide |
| SMILES | O=S1(=O)NN=Cc2ccccc21 |
| InChI | InChI=1S/C7H6N2O2S/c10-12(11)7-4-2-1-3-6(7)5-8-9-12/h1-5,9H |
| InChIKey | UOCUSOBVEHOMMB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide?
The IUPAC name of 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide (CID 3294423) is 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide.
What is the SMILES notation for 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide?
The canonical SMILES for 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide is O=S1(=O)NN=Cc2ccccc21.
What is the InChIKey of 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide?
The InChIKey is UOCUSOBVEHOMMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2S/c10-12(11)7-4-2-1-3-6(7)5-8-9-12/h1-5,9H.
What are the key properties of 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide?
2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide has a molecular weight of 182.20 g/mol, XLogP of 0.31, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide is sourced from PubChem (CID 3294423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).