C18H20F2N4OS — CID 3295167
N-[4-(difluoromethylsulfanyl)phenyl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide (PubChem CID 3295167) has the molecular formula C18H20F2N4OS and a molecular weight of 378.45 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 3295167 |
| Molecular Formula | C18H20F2N4OS |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCN(c2ccccn2)CC1)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C18H20F2N4OS/c19-18(20)26-15-6-4-14(5-7-15)22-17(25)13-23-9-11-24(12-10-23)16-3-1-2-8-21-16/h1-8,18H,9-13H2,(H,22,25) |
| InChIKey | UVHSKNPTKIGWIO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |