C22H24N2O3S — CID 32952998
(7S)-4-(2,3-dimethoxyphenyl)-2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-3-carboxamide (PubChem CID 32952998) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is (7S)-4-(2,3-dimethoxyphenyl)-2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | (7S)-4-(2,3-dimethoxyphenyl)-2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 32952998 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (7S)-4-(2,3-dimethoxyphenyl)-2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-3-carboxamide |
| SMILES | COc1cccc(-c2c(C(N)=O)c(C)nc3sc4c(c23)CC[C@H](C)C4)c1OC |
| InChI | InChI=1S/C22H24N2O3S/c1-11-8-9-13-16(10-11)28-22-19(13)18(17(21(23)25)12(2)24-22)14-6-5-7-15(26-3)20(14)27-4/h5-7,11H,8-10H2,1-4H3,(H2,23,25)/t11-/m0/s1 |
| InChIKey | JEERWSNKHPXLAA-NSHDSACASA-N |
| XLogP | 4.51 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |