About 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one
6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 3295525) has the molecular formula C22H20N2OS2
and a molecular weight of 392.55 g/mol. Its IUPAC name is 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 3295525 |
| Molecular Formula | C22H20N2OS2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2cc(-c3ccccc3)sc2[nH]c(=S)n1CCCCc1ccccc1 |
| InChI | InChI=1S/C22H20N2OS2/c25-21-18-15-19(17-12-5-2-6-13-17)27-20(18)23-22(26)24(21)14-8-7-11-16-9-3-1-4-10-16/h1-6,9-10,12-13,15H,7-8,11,14H2,(H,23,26) |
| InChIKey | ITSOSNORAZXKSE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CID 3295525) is 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one is O=c1c2cc(-c3ccccc3)sc2[nH]c(=S)n1CCCCc1ccccc1.
What is the InChIKey of 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one?
The InChIKey is ITSOSNORAZXKSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2OS2/c25-21-18-15-19(17-12-5-2-6-13-17)27-20(18)23-22(26)24(21)14-8-7-11-16-9-3-1-4-10-16/h1-6,9-10,12-13,15H,7-8,11,14H2,(H,23,26).
What are the key properties of 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one?
6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one has a molecular weight of 392.55 g/mol, XLogP of 5.81, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-3-(4-phenylbutyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 3295525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).