About [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate
[(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate (PubChem CID 32955623) has the molecular formula C20H16O6S
and a molecular weight of 384.41 g/mol. Its IUPAC name is [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate.
Molecular Properties
| Compound Name | [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate |
| PubChem CID | 32955623 |
| Molecular Formula | C20H16O6S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)c2ccc3oc(=O)ccc3c2)c2c1[C@H](C)CC2=O |
| InChI | InChI=1S/C20H16O6S/c1-11-3-6-17(20-15(21)9-12(2)19(11)20)26-27(23,24)14-5-7-16-13(10-14)4-8-18(22)25-16/h3-8,10,12H,9H2,1-2H3/t12-/m1/s1 |
| InChIKey | JTDQIPXPZFHHSU-GFCCVEGCSA-N |
| XLogP | 3.56 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate?
The IUPAC name of [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate (CID 32955623) is [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate.
What is the SMILES notation for [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate?
The canonical SMILES for [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate is Cc1ccc(OS(=O)(=O)c2ccc3oc(=O)ccc3c2)c2c1[C@H](C)CC2=O.
What is the InChIKey of [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate?
The InChIKey is JTDQIPXPZFHHSU-GFCCVEGCSA-N. The full InChI is InChI=1S/C20H16O6S/c1-11-3-6-17(20-15(21)9-12(2)19(11)20)26-27(23,24)14-5-7-16-13(10-14)4-8-18(22)25-16/h3-8,10,12H,9H2,1-2H3/t12-/m1/s1.
What are the key properties of [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate?
[(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate has a molecular weight of 384.41 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl] 2-oxochromene-6-sulfonate is sourced from PubChem (CID 32955623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).