C22H29N5O4 — CID 3295630
9-(4-ethoxyphenyl)-7-hydroxy-1-methyl-3-pentyl-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 3295630) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is 9-(4-ethoxyphenyl)-7-hydroxy-1-methyl-3-pentyl-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 9-(4-ethoxyphenyl)-7-hydroxy-1-methyl-3-pentyl-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3295630 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 9-(4-ethoxyphenyl)-7-hydroxy-1-methyl-3-pentyl-7,8-dihydro-6H-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | CCCCCn1c(=O)c2c(nc3n2CC(O)CN3c2ccc(OCC)cc2)n(C)c1=O |
| InChI | InChI=1S/C22H29N5O4/c1-4-6-7-12-25-20(29)18-19(24(3)22(25)30)23-21-26(13-16(28)14-27(18)21)15-8-10-17(11-9-15)31-5-2/h8-11,16,28H,4-7,12-14H2,1-3H3 |
| InChIKey | XEZZUMCYNWOPJP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|