About (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate
(2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate (PubChem CID 3295656) has the molecular formula C17H17N3O7S
and a molecular weight of 407.40 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate.
Molecular Properties
| Compound Name | (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate |
| PubChem CID | 3295656 |
| Molecular Formula | C17H17N3O7S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)NCC(=O)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N3O7S/c21-16(10-19-28(25,26)14-7-2-1-3-8-14)18-11-17(22)27-12-13-6-4-5-9-15(13)20(23)24/h1-9,19H,10-12H2,(H,18,21) |
| InChIKey | DZYHJVZHQVSFIQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate?
The IUPAC name of (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate (CID 3295656) is (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate.
What is the SMILES notation for (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate?
The canonical SMILES for (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate is O=C(CNS(=O)(=O)c1ccccc1)NCC(=O)OCc1ccccc1[N+](=O)[O-].
What is the InChIKey of (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate?
The InChIKey is DZYHJVZHQVSFIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O7S/c21-16(10-19-28(25,26)14-7-2-1-3-8-14)18-11-17(22)27-12-13-6-4-5-9-15(13)20(23)24/h1-9,19H,10-12H2,(H,18,21).
What are the key properties of (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate?
(2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate has a molecular weight of 407.40 g/mol, XLogP of 0.73, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)methyl 2-[[2-(benzenesulfonamido)acetyl]amino]acetate is sourced from PubChem (CID 3295656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).