C30H26FN3O6 — CID 3295806
N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-prop-2-enylbenzamide (PubChem CID 3295806) has the molecular formula C30H26FN3O6 and a molecular weight of 543.55 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 3295806 |
| Molecular Formula | C30H26FN3O6 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc(F)cc1)Cc1coc2ccccc2c1=O)C(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H26FN3O6/c1-3-14-32(30(37)22-11-8-20(2)26(15-22)34(38)39)18-28(35)33(16-21-9-12-24(31)13-10-21)17-23-19-40-27-7-5-4-6-25(27)29(23)36/h3-13,15,19H,1,14,16-18H2,2H3 |
| InChIKey | QHYBBHMWDOMLMP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|