C15H21N4O2S+ — CID 3296280
5-(3-methoxyphenyl)-4-methyl-2-(morpholin-4-ium-4-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 3296280) has the molecular formula C15H21N4O2S+ and a molecular weight of 321.43 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-4-methyl-2-(morpholin-4-ium-4-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 5-(3-methoxyphenyl)-4-methyl-2-(morpholin-4-ium-4-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 3296280 |
| Molecular Formula | C15H21N4O2S+ |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 5-(3-methoxyphenyl)-4-methyl-2-(morpholin-4-ium-4-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | COc1cccc(-c2nn(C[NH+]3CCOCC3)c(=S)n2C)c1 |
| InChI | InChI=1S/C15H20N4O2S/c1-17-14(12-4-3-5-13(10-12)20-2)16-19(15(17)22)11-18-6-8-21-9-7-18/h3-5,10H,6-9,11H2,1-2H3/p+1 |
| InChIKey | HXUDYELGMMQYAW-UHFFFAOYSA-O |
| XLogP | 0.50 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|