C30H25N3O2S2 — CID 3296531
4-[3-amino-4-(1,3-benzothiazol-2-yl)-5-(2,5-dimethylanilino)thiophen-2-yl]-7,8-dimethylchromen-2-one (PubChem CID 3296531) has the molecular formula C30H25N3O2S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is 4-[3-amino-4-(1,3-benzothiazol-2-yl)-5-(2,5-dimethylanilino)thiophen-2-yl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[3-amino-4-(1,3-benzothiazol-2-yl)-5-(2,5-dimethylanilino)thiophen-2-yl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 3296531 |
| Molecular Formula | C30H25N3O2S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 4-[3-amino-4-(1,3-benzothiazol-2-yl)-5-(2,5-dimethylanilino)thiophen-2-yl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc(C)c(Nc2sc(-c3cc(=O)oc4c(C)c(C)ccc34)c(N)c2-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C30H25N3O2S2/c1-15-9-10-17(3)22(13-15)33-30-25(29-32-21-7-5-6-8-23(21)36-29)26(31)28(37-30)20-14-24(34)35-27-18(4)16(2)11-12-19(20)27/h5-14,33H,31H2,1-4H3 |
| InChIKey | GPLUPDNOWGUAKE-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|