C13H12Cl2N2O3 — CID 3296637
2-[(2,2-dichloroacetyl)amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 3296637) has the molecular formula C13H12Cl2N2O3 and a molecular weight of 315.16 g/mol. Its IUPAC name is 2-[(2,2-dichloroacetyl)amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[(2,2-dichloroacetyl)amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 3296637 |
| Molecular Formula | C13H12Cl2N2O3 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-[(2,2-dichloroacetyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)O)C(Cl)Cl |
| InChI | InChI=1S/C13H12Cl2N2O3/c14-11(15)12(18)17-10(13(19)20)5-7-6-16-9-4-2-1-3-8(7)9/h1-4,6,10-11,16H,5H2,(H,17,18)(H,19,20) |
| InChIKey | FFHVZDPRFGMVIM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|