C28H28N4S — CID 3296722
3-(4-tert-butylphenyl)-6,7-bis(4-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 3296722) has the molecular formula C28H28N4S and a molecular weight of 452.63 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-6,7-bis(4-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 3-(4-tert-butylphenyl)-6,7-bis(4-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 3296722 |
| Molecular Formula | C28H28N4S |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 3-(4-tert-butylphenyl)-6,7-bis(4-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | Cc1ccc(C2=Nn3c(nnc3-c3ccc(C(C)(C)C)cc3)SC2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H28N4S/c1-18-6-10-20(11-7-18)24-25(21-12-8-19(2)9-13-21)33-27-30-29-26(32(27)31-24)22-14-16-23(17-15-22)28(3,4)5/h6-17,25H,1-5H3 |
| InChIKey | MXFTYNFXLUTRBX-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |