About adamantane-2-thione
adamantane-2-thione (PubChem CID 3296738) has the molecular formula C10H14S
and a molecular weight of 166.29 g/mol. Its IUPAC name is adamantane-2-thione.
Molecular Properties
| Compound Name | adamantane-2-thione |
| PubChem CID | 3296738 |
| Molecular Formula | C10H14S |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | adamantane-2-thione |
| SMILES | S=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C10H14S/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-9H,1-5H2 |
| InChIKey | NKTSSCWRJVACFR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze adamantane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane-2-thione?
The IUPAC name of adamantane-2-thione (CID 3296738) is adamantane-2-thione.
What is the SMILES notation for adamantane-2-thione?
The canonical SMILES for adamantane-2-thione is S=C1C2CC3CC(C2)CC1C3.
What is the InChIKey of adamantane-2-thione?
The InChIKey is NKTSSCWRJVACFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-9H,1-5H2.
What are the key properties of adamantane-2-thione?
adamantane-2-thione has a molecular weight of 166.29 g/mol, XLogP of 2.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane-2-thione is sourced from PubChem (CID 3296738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).