C25H17N3O6S — CID 3296917
methyl 4-(4-nitrophenyl)-2,3-dioxo-1-phenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate (PubChem CID 3296917) has the molecular formula C25H17N3O6S and a molecular weight of 487.49 g/mol. Its IUPAC name is methyl 4-(4-nitrophenyl)-2,3-dioxo-1-phenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate.
| Compound Name | methyl 4-(4-nitrophenyl)-2,3-dioxo-1-phenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate |
|---|---|
| PubChem CID | 3296917 |
| Molecular Formula | C25H17N3O6S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | methyl 4-(4-nitrophenyl)-2,3-dioxo-1-phenyl-5H-pyrrolo[2,3-b][1,5]benzothiazepine-10a-carboxylate |
| SMILES | COC(=O)C12Sc3ccccc3NC(c3ccc([N+](=O)[O-])cc3)=C1C(=O)C(=O)N2c1ccccc1 |
| InChI | InChI=1S/C25H17N3O6S/c1-34-24(31)25-20(22(29)23(30)27(25)16-7-3-2-4-8-16)21(15-11-13-17(14-12-15)28(32)33)26-18-9-5-6-10-19(18)35-25/h2-14,26H,1H3 |
| InChIKey | MRZSFYZMLSIZSP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|