About 3-butyl-2-heptan-3-yl-1,3-oxazolidine
3-butyl-2-heptan-3-yl-1,3-oxazolidine (PubChem CID 3297025) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is 3-butyl-2-heptan-3-yl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 3-butyl-2-heptan-3-yl-1,3-oxazolidine |
| PubChem CID | 3297025 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 3-butyl-2-heptan-3-yl-1,3-oxazolidine |
| SMILES | CCCCC(CC)C1OCCN1CCCC |
| InChI | InChI=1S/C14H29NO/c1-4-7-9-13(6-3)14-15(10-8-5-2)11-12-16-14/h13-14H,4-12H2,1-3H3 |
| InChIKey | CYMHAQCMKNVHPA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyl-2-heptan-3-yl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-2-heptan-3-yl-1,3-oxazolidine?
The IUPAC name of 3-butyl-2-heptan-3-yl-1,3-oxazolidine (CID 3297025) is 3-butyl-2-heptan-3-yl-1,3-oxazolidine.
What is the SMILES notation for 3-butyl-2-heptan-3-yl-1,3-oxazolidine?
The canonical SMILES for 3-butyl-2-heptan-3-yl-1,3-oxazolidine is CCCCC(CC)C1OCCN1CCCC.
What is the InChIKey of 3-butyl-2-heptan-3-yl-1,3-oxazolidine?
The InChIKey is CYMHAQCMKNVHPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-4-7-9-13(6-3)14-15(10-8-5-2)11-12-16-14/h13-14H,4-12H2,1-3H3.
What are the key properties of 3-butyl-2-heptan-3-yl-1,3-oxazolidine?
3-butyl-2-heptan-3-yl-1,3-oxazolidine has a molecular weight of 227.39 g/mol, XLogP of 3.66, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2-heptan-3-yl-1,3-oxazolidine is sourced from PubChem (CID 3297025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).