About 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one
2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one (PubChem CID 3297067) has the molecular formula C10H14ClN3OS
and a molecular weight of 259.76 g/mol. Its IUPAC name is 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one |
| PubChem CID | 3297067 |
| Molecular Formula | C10H14ClN3OS |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)CSC1c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C10H14ClN3OS/c1-4-14-7(15)5-16-10(14)8-6(2)12-13(3)9(8)11/h10H,4-5H2,1-3H3 |
| InChIKey | ODUGVYVJYUIZKO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one?
The IUPAC name of 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one (CID 3297067) is 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one is CCN1C(=O)CSC1c1c(C)nn(C)c1Cl.
What is the InChIKey of 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one?
The InChIKey is ODUGVYVJYUIZKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3OS/c1-4-14-7(15)5-16-10(14)8-6(2)12-13(3)9(8)11/h10H,4-5H2,1-3H3.
What are the key properties of 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one?
2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one has a molecular weight of 259.76 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-3-ethyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 3297067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).