C50H63NO6 — CID 3298192
N-(1-adamantylmethyl)-N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl)methyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 3298192) has the molecular formula C50H63NO6 and a molecular weight of 774.05 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl)methyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-(1-adamantylmethyl)-N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl)methyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3298192 |
| Molecular Formula | C50H63NO6 |
| Molecular Weight | 774.05 g/mol |
| Exact Mass | 773.47 |
| IUPAC Name | N-(1-adamantylmethyl)-N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl)methyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N(CC23CC4CC(CC(C4)C2)C3)CC2(O)CCC3C45C=CC6(C=C4C(=O)c4ccccc4)CC(O)CCC6(C)C5CCC32C)cc1OC |
| InChI | InChI=1S/C50H63NO6/c1-45-15-12-37(52)28-48(45)18-19-50(38(29-48)44(54)36-8-6-5-7-9-36)41(45)13-16-46(2)42(50)14-17-49(46,55)31-51(30-47-25-33-20-34(26-47)22-35(21-33)27-47)43(53)24-32-10-11-39(56-3)40(23-32)57-4/h5-11,18-19,23,29,33-35,37,41-42,52,55H,12-17,20-22,24-28,30-31H2,1-4H3 |
| InChIKey | LDDYCRXRRUERJJ-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.05 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|