C25H30O3 — CID 3298295
9-[1-(4-propan-2-ylphenyl)propan-2-yl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 3298295) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is 9-[1-(4-propan-2-ylphenyl)propan-2-yl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[1-(4-propan-2-ylphenyl)propan-2-yl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 3298295 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 9-[1-(4-propan-2-ylphenyl)propan-2-yl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | CC(C)c1ccc(CC(C)C2C3=C(CCCC3=O)OC3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C25H30O3/c1-15(2)18-12-10-17(11-13-18)14-16(3)23-24-19(26)6-4-8-21(24)28-22-9-5-7-20(27)25(22)23/h10-13,15-16,23H,4-9,14H2,1-3H3 |
| InChIKey | TZUMUGLNHNZAKZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |