C29H19BrCl2F3N3O5 — CID 3298635
9-bromo-6-(5-chloro-2-hydroxyphenyl)-2-[[3-chloro-6-(trifluoromethyl)-2-pyridinyl]-methylamino]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3298635) has the molecular formula C29H19BrCl2F3N3O5 and a molecular weight of 697.29 g/mol. Its IUPAC name is 9-bromo-6-(5-chloro-2-hydroxyphenyl)-2-[[3-chloro-6-(trifluoromethyl)-2-pyridinyl]-methylamino]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-6-(5-chloro-2-hydroxyphenyl)-2-[[3-chloro-6-(trifluoromethyl)-2-pyridinyl]-methylamino]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3298635 |
| Molecular Formula | C29H19BrCl2F3N3O5 |
| Molecular Weight | 697.29 g/mol |
| Exact Mass | 694.98 |
| IUPAC Name | 9-bromo-6-(5-chloro-2-hydroxyphenyl)-2-[[3-chloro-6-(trifluoromethyl)-2-pyridinyl]-methylamino]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CN(c1nc(C(F)(F)F)ccc1Cl)N1C(=O)C2CC=C3C(c4cc(Cl)ccc4O)C4=C(CC3C2C1=O)C(=O)C(Br)=CC4=O |
| InChI | InChI=1S/C29H19BrCl2F3N3O5/c1-37(26-18(32)5-7-21(36-26)29(33,34)35)38-27(42)13-4-3-12-14(23(13)28(38)43)9-16-24(20(40)10-17(30)25(16)41)22(12)15-8-11(31)2-6-19(15)39/h2-3,5-8,10,13-14,22-23,39H,4,9H2,1H3 |
| InChIKey | BICCYIWSECIMDQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.29 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|