C19H21NO3 — CID 32993567
(2,4,6-trimethylphenyl) 2-(4-acetamidophenyl)acetate (PubChem CID 32993567) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) 2-(4-acetamidophenyl)acetate.
| Compound Name | (2,4,6-trimethylphenyl) 2-(4-acetamidophenyl)acetate |
|---|---|
| PubChem CID | 32993567 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (2,4,6-trimethylphenyl) 2-(4-acetamidophenyl)acetate |
| SMILES | CC(=O)Nc1ccc(CC(=O)Oc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H21NO3/c1-12-9-13(2)19(14(3)10-12)23-18(22)11-16-5-7-17(8-6-16)20-15(4)21/h5-10H,11H2,1-4H3,(H,20,21) |
| InChIKey | HIKAPVPSJAOKKY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|