C18H18IN3O4 — CID 3299574
N-(3-iodo-4-methylphenyl)-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 3299574) has the molecular formula C18H18IN3O4 and a molecular weight of 467.26 g/mol. Its IUPAC name is N-(3-iodo-4-methylphenyl)-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-(3-iodo-4-methylphenyl)-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 3299574 |
| Molecular Formula | C18H18IN3O4 |
| Molecular Weight | 467.26 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | N-(3-iodo-4-methylphenyl)-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)cc1I |
| InChI | InChI=1S/C18H18IN3O4/c1-12-2-4-14(11-15(12)19)20-18(23)13-3-5-16(17(10-13)22(24)25)21-6-8-26-9-7-21/h2-5,10-11H,6-9H2,1H3,(H,20,23) |
| InChIKey | PONHYFYMDILLJZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|