About 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione
8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione (PubChem CID 3299932) has the molecular formula C17H17BrN4O4
and a molecular weight of 421.25 g/mol. Its IUPAC name is 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione.
Molecular Properties
| Compound Name | 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione |
| PubChem CID | 3299932 |
| Molecular Formula | C17H17BrN4O4 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(-c1cc3c(cc1Br)OCO3)n2C |
| InChI | InChI=1S/C17H17BrN4O4/c1-3-4-5-22-15-13(16(23)20-17(22)24)21(2)14(19-15)9-6-11-12(7-10(9)18)26-8-25-11/h6-7H,3-5,8H2,1-2H3,(H,20,23,24) |
| InChIKey | XTPPLTQYSMJXHB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione?
The IUPAC name of 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione (CID 3299932) is 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione.
What is the SMILES notation for 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione?
The canonical SMILES for 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione is CCCCn1c(=O)[nH]c(=O)c2c1nc(-c1cc3c(cc1Br)OCO3)n2C.
What is the InChIKey of 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione?
The InChIKey is XTPPLTQYSMJXHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrN4O4/c1-3-4-5-22-15-13(16(23)20-17(22)24)21(2)14(19-15)9-6-11-12(7-10(9)18)26-8-25-11/h6-7H,3-5,8H2,1-2H3,(H,20,23,24).
What are the key properties of 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione?
8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione has a molecular weight of 421.25 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(6-bromo-1,3-benzodioxol-5-yl)-3-butyl-7-methylpurine-2,6-dione is sourced from PubChem (CID 3299932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).