C11H15N5O — CID 3300194
(12,12-dimethyl-11-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-3-yl)hydrazine (PubChem CID 3300194) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is (12,12-dimethyl-11-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-3-yl)hydrazine.
| Compound Name | (12,12-dimethyl-11-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-3-yl)hydrazine |
|---|---|
| PubChem CID | 3300194 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | (12,12-dimethyl-11-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-3-yl)hydrazine |
| SMILES | CC1(C)Cc2c([nH]c3ncnc(NN)c23)CO1 |
| InChI | InChI=1S/C11H15N5O/c1-11(2)3-6-7(4-17-11)15-9-8(6)10(16-12)14-5-13-9/h5H,3-4,12H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | BMHOPBCOXQHJND-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|