About 2-amino-3-phenylpropanal
2-amino-3-phenylpropanal (PubChem CID 3300397) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-amino-3-phenylpropanal.
Molecular Properties
| Compound Name | 2-amino-3-phenylpropanal |
| PubChem CID | 3300397 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2-amino-3-phenylpropanal |
| SMILES | NC(C=O)Cc1ccccc1 |
| InChI | InChI=1S/C9H11NO/c10-9(7-11)6-8-4-2-1-3-5-8/h1-5,7,9H,6,10H2 |
| InChIKey | CQIUZHAQYHXKRY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-phenylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-phenylpropanal?
The IUPAC name of 2-amino-3-phenylpropanal (CID 3300397) is 2-amino-3-phenylpropanal.
What is the SMILES notation for 2-amino-3-phenylpropanal?
The canonical SMILES for 2-amino-3-phenylpropanal is NC(C=O)Cc1ccccc1.
What is the InChIKey of 2-amino-3-phenylpropanal?
The InChIKey is CQIUZHAQYHXKRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c10-9(7-11)6-8-4-2-1-3-5-8/h1-5,7,9H,6,10H2.
What are the key properties of 2-amino-3-phenylpropanal?
2-amino-3-phenylpropanal has a molecular weight of 149.19 g/mol, XLogP of 0.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-phenylpropanal is sourced from PubChem (CID 3300397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).